| Compound Information | SONAR Target prediction | | Name: | 5,4`-DIMETHOXYFLAVONE | | Unique Identifier: | SPE00211227 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(cc1)C1Oc2cccc(OC)c2C(=O)C=1 |
| Species: |
4932 |
| Condition: |
ELG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7167±0.0114551 |
| Normalized OD Score: sc h |
1.0147±0.00574063 |
| Z-Score: |
0.9169±0.349745 |
| p-Value: |
0.373722 |
| Z-Factor: |
-8.70824 |
| Fitness Defect: |
0.9842 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2007-10-10 YYYY-MM-DD | | Plate CH Control (+): | 0.039349999999999996±0.00069 | | Plate DMSO Control (-): | 0.6951750000000001±0.11159 | | Plate Z-Factor: | 0.4419 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 688669 |
5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 | |
|