| 
 | Compound Information | SONAR Target prediction |  | Name: | 5,4`-DIMETHOXYFLAVONE |  | Unique Identifier: | SPE00211227 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C17H14O4 |  | Molecular Weight: | 268.18 g/mol |  | X log p: | 17.421  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccc(cc1)C1Oc2cccc(OC)c2C(=O)C=1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | COT1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7122±0.00212132 |  
		| Normalized OD Score: sc h | 1.0218±0.0000963565 |  
		| Z-Score: | 1.1312±0.0194052 |  
		| p-Value: | 0.258 |  
		| Z-Factor: | -4.4341 |  
		| Fitness Defect: | 1.3548 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|E4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.50 Celcius |  | Date: | 2007-11-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.040325±0.00105 |  | Plate DMSO Control (-): | 0.6809499999999999±0.03345 |  | Plate Z-Factor: | 0.8541 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 688669 | 5-methoxy-2-(4-methoxyphenyl)chromen-4-one |  
 
 | active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 |  | 
 
 |