| Compound Information | SONAR Target prediction | | Name: | 4,6-DIMETHOXY-5-METHYLISOFLAVONE | | Unique Identifier: | SPE00211076 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 280.19 g/mol | | X log p: | 15.438 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cc2OC=C(C(=O)c2c(OC)c1C)c1ccccc1 | | Source: | analog |
| Species: |
4932 |
| Condition: |
GCN5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.1789±0.0185262 |
| Normalized OD Score: sc h |
0.7072±0.0112928 |
| Z-Score: |
-5.0178±0.159213 |
| p-Value: |
0.0000006111 |
| Z-Factor: |
-4.26188 |
| Fitness Defect: |
14.308 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 22|G6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2007-10-30 YYYY-MM-DD | | Plate CH Control (+): | 0.041125±0.00044 | | Plate DMSO Control (-): | 0.25482499999999997±0.07918 | | Plate Z-Factor: | -0.2904 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6710721 |
5,7-dimethoxy-6-methyl-3-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 9315 | Additional Members: 4 | Rows returned: 1 | |
|
