Compound Information | SONAR Target prediction | Name: | 4,6-DIMETHOXY-5-METHYLISOFLAVONE | Unique Identifier: | SPE00211076 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 280.19 g/mol | X log p: | 15.438 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc2OC=C(C(=O)c2c(OC)c1C)c1ccccc1 | Source: | analog |
Species: |
4932 |
Condition: |
TOP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5349±0.00650538 |
Normalized OD Score: sc h |
0.8411±0.00534262 |
Z-Score: |
-2.5661±0.212865 |
p-Value: |
0.0111534 |
Z-Factor: |
0.378771 |
Fitness Defect: |
4.496 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 22|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2006-04-26 YYYY-MM-DD | Plate CH Control (+): | 0.0393±0.00127 | Plate DMSO Control (-): | 0.6044±0.01625 | Plate Z-Factor: | 0.9051 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6710721 |
5,7-dimethoxy-6-methyl-3-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 9315 | Additional Members: 4 | Rows returned: 1 | |
|