| Compound Information | SONAR Target prediction |  | Name: | 4,6-DIMETHOXY-5-METHYLISOFLAVONE |  | Unique Identifier: | SPE00211076  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 280.19 g/mol |  | X log p: | 15.438  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1cc2OC=C(C(=O)c2c(OC)c1C)c1ccccc1 |  | Source: | analog |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MRT4 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5137±0.00890955 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9411±0.00694167 | 
	 
	
		| Z-Score: | 
		-1.9743±0.515446 | 
	 
	
		| p-Value: | 
		0.0633932 | 
	 
	
		| Z-Factor: | 
		-309.606 | 
	 
	
		| Fitness Defect: | 
		2.7584 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 22|G6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.00 Celcius |  | Date: | 2007-08-30 YYYY-MM-DD |  | Plate CH Control (+): | 0.03985±0.00053 |  | Plate DMSO Control (-): | 0.532525±0.11330 |  | Plate Z-Factor: | 0.2534 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 6710721 | 
		5,7-dimethoxy-6-methyl-3-phenyl-chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 9 | 1 2 Next >>  |   
 |  active | Cluster 9315 | Additional Members: 4 | Rows returned: 1 |  |   
 
 |