| Compound Information | SONAR Target prediction | | Name: | 4,6-DIMETHOXY-5-METHYLISOFLAVONE | | Unique Identifier: | SPE00211076 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 280.19 g/mol | | X log p: | 15.438 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cc2OC=C(C(=O)c2c(OC)c1C)c1ccccc1 | | Source: | analog |
| Species: |
4932 |
| Condition: |
GIM4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7244±0.00275772 |
| Normalized OD Score: sc h |
0.9782±0.0025023 |
| Z-Score: |
-1.0117±0.10353 |
| p-Value: |
0.312994 |
| Z-Factor: |
-2.9836 |
| Fitness Defect: |
1.1616 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 25|D4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2008-03-20 YYYY-MM-DD | | Plate CH Control (+): | 0.04095±0.00043 | | Plate DMSO Control (-): | 0.7284999999999999±0.01869 | | Plate Z-Factor: | 0.9166 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 6710721 |
5,7-dimethoxy-6-methyl-3-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 9315 | Additional Members: 4 | Rows returned: 1 | |
|