Compound Information | SONAR Target prediction | Name: | 4,6-DIMETHOXY-5-METHYLISOFLAVONE | Unique Identifier: | SPE00211076 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 280.19 g/mol | X log p: | 15.438 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc2OC=C(C(=O)c2c(OC)c1C)c1ccccc1 | Source: | analog |
Species: |
4932 |
Condition: |
BRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6494±0.00473762 |
Normalized OD Score: sc h |
0.9305±0.00319801 |
Z-Score: |
-2.8119±0.106308 |
p-Value: |
0.00504656 |
Z-Factor: |
0.143716 |
Fitness Defect: |
5.289 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 22|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2006-03-16 YYYY-MM-DD | Plate CH Control (+): | 0.038849999999999996±0.00249 | Plate DMSO Control (-): | 0.672925±0.01160 | Plate Z-Factor: | 0.9278 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6710721 |
5,7-dimethoxy-6-methyl-3-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 9315 | Additional Members: 4 | Rows returned: 1 | |
|