Compound Information | SONAR Target prediction | Name: | CUNEATIN METHYL ETHER | Unique Identifier: | SPE00210556 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.189 g/mol | X log p: | 14.131 (online calculus) | Lipinksi Failures | 1 | TPSA | 63.22 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C(=COc2c1)c1cc2OCOc2cc1OC | Source: | Pterodon apparicioi | Reference: | Phytochemistry 1974: 2593 (1974) |
Species: |
4932 |
Condition: |
VPS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6229±0.0195869 |
Normalized OD Score: sc h |
1.0057±0.0622496 |
Z-Score: |
0.2677±2.47374 |
p-Value: |
0.0910892 |
Z-Factor: |
-10.0393 |
Fitness Defect: |
2.3959 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2007-10-03 YYYY-MM-DD | Plate CH Control (+): | 0.040225±0.00068 | Plate DMSO Control (-): | 0.624675±0.13361 | Plate Z-Factor: | 0.2537 |
| png ps pdf |
DBLink | Rows returned: 2 | |
343083 |
7-methoxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |
5385091 |
7-hydroxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
nonactive | Cluster 13403 | Additional Members: 2 | Rows returned: 1 | |
|