Compound Information | SONAR Target prediction | Name: | CUNEATIN METHYL ETHER | Unique Identifier: | SPE00210556 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 312.189 g/mol | X log p: | 14.131 (online calculus) | Lipinksi Failures | 1 | TPSA | 63.22 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C(=COc2c1)c1cc2OCOc2cc1OC | Source: | Pterodon apparicioi | Reference: | Phytochemistry 1974: 2593 (1974) |
Species: |
4932 |
Condition: |
SNF2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6834±0.025668 |
Normalized OD Score: sc h |
1.0227±0.00799483 |
Z-Score: |
0.8651±0.226881 |
p-Value: |
0.393052 |
Z-Factor: |
-2.70982 |
Fitness Defect: |
0.9338 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 25|C10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.20 Celcius | Date: | 2008-02-01 YYYY-MM-DD | Plate CH Control (+): | 0.040075±0.00045 | Plate DMSO Control (-): | 0.639625±0.01542 | Plate Z-Factor: | 0.9123 |
| png ps pdf |
DBLink | Rows returned: 2 | |
343083 |
7-methoxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |
5385091 |
7-hydroxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 13403 | Additional Members: 2 | Rows returned: 1 | |
|