| Compound Information | SONAR Target prediction | | Name: | CUNEATIN METHYL ETHER | | Unique Identifier: | SPE00210556 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 312.189 g/mol | | X log p: | 14.131 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 63.22 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc2C(=O)C(=COc2c1)c1cc2OCOc2cc1OC | | Source: | Pterodon apparicioi | | Reference: | Phytochemistry 1974: 2593 (1974) |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6131±0.00304056 |
| Normalized OD Score: sc h |
1.0294±0.0127248 |
| Z-Score: |
1.7572±0.648462 |
| p-Value: |
0.110384 |
| Z-Factor: |
-5.97005 |
| Fitness Defect: |
2.2038 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 25|C10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2008-08-22 YYYY-MM-DD | | Plate CH Control (+): | 0.04035±0.00078 | | Plate DMSO Control (-): | 0.588225±0.01262 | | Plate Z-Factor: | 0.9324 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 343083 |
7-methoxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |
| 5385091 |
7-hydroxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 13403 | Additional Members: 2 | Rows returned: 1 | |
|
