| 
 | Compound Information | SONAR Target prediction |  | Name: | CUNEATIN METHYL ETHER |  | Unique Identifier: | SPE00210556 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 312.189 g/mol |  | X log p: | 14.131  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 63.22 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccc2C(=O)C(=COc2c1)c1cc2OCOc2cc1OC |  | Source: | Pterodon apparicioi |  | Reference: | Phytochemistry 1974: 2593 (1974) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | CIN8 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6966±0.0125158 |  
		| Normalized OD Score: sc h | 1.0211±0.0198649 |  
		| Z-Score: | 1.6290±1.10632 |  
		| p-Value: | 0.20652 |  
		| Z-Factor: | -2.57415 |  
		| Fitness Defect: | 1.5774 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 25|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.50 Celcius |  | Date: | 2008-02-06 YYYY-MM-DD |  | Plate CH Control (+): | 0.041449999999999994±0.00044 |  | Plate DMSO Control (-): | 0.656675±0.01130 |  | Plate Z-Factor: | 0.9423 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 2 |  | 
 
	
		| 343083 | 7-methoxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |  
		| 5385091 | 7-hydroxy-3-(6-methoxybenzo[1,3]dioxol-5-yl)chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 13403 | Additional Members: 2 | Rows returned: 1 |  | 
 
 |