| Compound Information | SONAR Target prediction |
| Name: | GENISTEIN |
| Unique Identifier: | SPE00210296 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 260.158 g/mol |
| X log p: | 14.737 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 26.3 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | Oc1ccc(cc1)C1=COc2cc(O)cc(O)c2C1=O |
| Class: | isoflavone |
| Source: | widely distributed in Leguminoseae |
| Reference: | Phytochemistry 7: 791 (1968) |
| Generic_name: | 5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-4H-1-B |
| Chemical_iupac_name: | GENISTEIN |
| Drug_type: | Experimental |
| Kegg_compound_id: | C06563 |
| Drugbank_id: | EXPT01582 |
| Logp: | 1.89 |
| Cas_registry_number: | 446-72-0 |
| Drug_category: | Estrogen Receptor Beta inhibitor |
| Organisms_affected: | -1 |
| Found: 204 nonactive | as graph: single | with analogs | [1] << Back 171 172 173 174 175 176 177 178 179 180 Next >> [204] |
| Species: | 4932 |
| Condition: | SDH2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7270±0.00219203 |
| Normalized OD Score: sc h | 1.0030±0.00515708 |
| Z-Score: | 0.1678±0.290849 |
| p-Value: | 0.8393 |
| Z-Factor: | -9.40968 |
| Fitness Defect: | 0.1752 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 2 |
| 5280961 | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| 11000304 | 6,8-dideuterio-5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 17 | 1 2 3 Next >> |
| SPE00211076 | 0.9008 |
| SPE00201182 | 0.9084 |
| SPE00201310 | 0.9141 |
| SPE00201355 | 0.9225 |
| SPE00201309 | 0.9286 |
| BTB 12551 | 0.9333 |
| active | Cluster 14679 | Additional Members: 9 | Rows returned: 4 |
| SPE01500726 | 0.362068965517241 |
| SPE10100004 | 0.245283018867924 |
| SPE00240565 | 0.235294117647059 |
| SPE10100003 | 0 |
Service provided by the
Mike Tyers Laboratory