| Compound Information | SONAR Target prediction | | Name: | EPIGALLOCATECHIN-3-MONOGALLATE | | Unique Identifier: | SPE00210239 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 440.229 g/mol | | X log p: | 15.067 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | Oc1cc(O)c2CC(OC(=O)c3cc(O)c(O)c(O)c3)C(Oc2c1)c1cc(O)c(O)c(O)c1 | | Class: | flavan | | Source: | tea pigment |
| Species: |
4932 |
| Condition: |
RBL2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6503±0.00318198 |
| Normalized OD Score: sc h |
0.9124±0.00415204 |
| Z-Score: |
-4.9133±0.156254 |
| p-Value: |
0.00000103579 |
| Z-Factor: |
0.0788523 |
| Fitness Defect: |
13.7803 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 13|G8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.00 Celcius | | Date: | 2008-06-03 YYYY-MM-DD | | Plate CH Control (+): | 0.040175±0.00082 | | Plate DMSO Control (-): | 0.706175±0.01562 | | Plate Z-Factor: | 0.9138 |
| png ps pdf |
| 367141 |
[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 2824823 |
[(2S,3S)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 5276454 |
[(2R,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 5276890 |
[(2R,3S)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 6419835 |
[(2S,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 11983314 |
copper [(2R,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8942 | Additional Members: 11 | Rows returned: 7 | 1 2 Next >> |
|