| 
 | Compound Information | SONAR Target prediction |  | Name: | EPICATECHIN MONOGALLATE |  | Unique Identifier: | SPE00210238 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 424.229 g/mol |  | X log p: | 16.656  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 10 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | Oc1cc(O)c2CC(OC(=O)c3cc(O)c(O)c(O)c3)C(Oc2c1)c1ccc(O)c(O)c1 |  | Class: | flavan |  | Source: | tea pigment | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SAC3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4714±0.00820244 |  
		| Normalized OD Score: sc h | 1.1162±0.0421484 |  
		| Z-Score: | 3.5620±1.22467 |  
		| p-Value: | 0.00351328 |  
		| Z-Factor: | -1.36769 |  
		| Fitness Defect: | 5.6512 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 12|D2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.20 Celcius |  | Date: | 2008-05-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.04035±0.00042 |  | Plate DMSO Control (-): | 0.43062500000000004±0.02153 |  | Plate Z-Factor: | 0.8281 | 
 |  png ps
 pdf
 | 
 
 
	
		| 1287 | [5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate |  
		| 65056 | [(2S,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |  
		| 65064 | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate |  
		| 107905 | [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |  
		| 156196 | [(2R,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4-dihydroxybenzoate |  
		| 199472 | [(2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate |  
 | internal high similarity DBLink  | Rows returned: 4 |  | 
 
 | active | Cluster 8942 | Additional Members: 11 | Rows returned: 7 | 1 2 Next >> | 
 
 |