| Compound Information | SONAR Target prediction |  | Name: | EPICATECHIN MONOGALLATE |  | Unique Identifier: | SPE00210238  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 424.229 g/mol |  | X log p: | 16.656  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 10 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | Oc1cc(O)c2CC(OC(=O)c3cc(O)c(O)c(O)c3)C(Oc2c1)c1ccc(O)c(O)c1 |  | Class: | flavan |  | Source: | tea pigment |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BY4741-2nd | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7015±0.0072832 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9731±0.00972429 | 
	 
	
		| Z-Score: | 
		-2.1797±0.307388 | 
	 
	
		| p-Value: | 
		0.0331262 | 
	 
	
		| Z-Factor: | 
		-0.317522 | 
	 
	
		| Fitness Defect: | 
		3.4074 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 12|D2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.20 Celcius |  | Date: | 2008-02-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0404±0.00058 |  | Plate DMSO Control (-): | 0.6767500000000001±0.01870 |  | Plate Z-Factor: | 0.9188 |  
  |  png ps pdf |  
 
 
	
		| 1287 | 
		[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate | 
	 
	
		| 65056 | 
		[(2S,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate | 
	 
	
		| 65064 | 
		[(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate | 
	 
	
		| 107905 | 
		[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate | 
	 
	
		| 156196 | 
		[(2R,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,4-dihydroxybenzoate | 
	 
	
		| 199472 | 
		[(2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 8942 | Additional Members: 11 | Rows returned: 7 | 1 2 Next >>  |   
 
 |