| 
 | Compound Information | SONAR Target prediction |  | Name: | DIHYDROMUNDULETONE |  | Unique Identifier: | SPE00210203 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C25H28O6 |  | Molecular Weight: | 396.264 g/mol |  | X log p: | 12.387  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1c(CC(=O)c2cc3CC(O)C(C)(C)Oc3cc2O)ccc2OC(C)(C)C=Cc21 |  | Source: | derivative of mundulone |  | Reference: | Proc Chem Soc 1959: 150 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE01500377 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4477±0.00219203 |  
		| Normalized OD Score: sc h | 0.7531±0.00633005 |  
		| Z-Score: | -6.7118±0.677524 |  
		| p-Value: | 0.000000000229484 |  
		| Z-Factor: | 0.262202 |  
		| Fitness Defect: | 22.1952 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|D4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.30 Celcius |  | Date: | 2006-12-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.038675±0.00211 |  | Plate DMSO Control (-): | 0.6208750000000001±0.03832 |  | Plate Z-Factor: | 0.8000 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 3492326 | 1-(3,7-dihydroxy-2,2-dimethyl-chroman-6-yl)-2-(5-methoxy-2,2-dimethyl-chromen-6-yl)ethanone |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | nonactive | Cluster 2161 | Additional Members: 6 | Rows returned: 5 |  | 
 
 |