| Compound Information | SONAR Target prediction | | Name: | DIHYDROMUNDULETONE | | Unique Identifier: | SPE00210203 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C25H28O6 | | Molecular Weight: | 396.264 g/mol | | X log p: | 12.387 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1c(CC(=O)c2cc3CC(O)C(C)(C)Oc3cc2O)ccc2OC(C)(C)C=Cc21 | | Source: | derivative of mundulone | | Reference: | Proc Chem Soc 1959: 150 |
| Species: |
4932 |
| Condition: |
IRE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7595±0.00254558 |
| Normalized OD Score: sc h |
0.9798±0.00437471 |
| Z-Score: |
0.0929±0.238074 |
| p-Value: |
0.866882 |
| Z-Factor: |
-9.7513 |
| Fitness Defect: |
0.1429 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 16|C11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09550000000000002±0.00669 | | Plate DMSO Control (-): | 0.9262499999999998±0.04348 | | Plate Z-Factor: | 0.7852 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 3492326 |
1-(3,7-dihydroxy-2,2-dimethyl-chroman-6-yl)-2-(5-methoxy-2,2-dimethyl-chromen-6-yl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 | |
|
