| 
 | Compound Information | SONAR Target prediction |  | Name: | DIHYDROMUNDULETONE |  | Unique Identifier: | SPE00210203 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C25H28O6 |  | Molecular Weight: | 396.264 g/mol |  | X log p: | 12.387  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 44.76 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1c(CC(=O)c2cc3CC(O)C(C)(C)Oc3cc2O)ccc2OC(C)(C)C=Cc21 |  | Source: | derivative of mundulone |  | Reference: | Proc Chem Soc 1959: 150 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE00201539 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5394±0.00212132 |  
		| Normalized OD Score: sc h | 0.9844±0.0104725 |  
		| Z-Score: | -0.3712±0.230065 |  
		| p-Value: | 0.71415 |  
		| Z-Factor: | -9.24363 |  
		| Fitness Defect: | 0.3367 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|D4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.50 Celcius |  | Date: | 2006-11-29 YYYY-MM-DD |  | Plate CH Control (+): | 0.042124999999999996±0.00225 |  | Plate DMSO Control (-): | 0.48529999999999995±0.11363 |  | Plate Z-Factor: | 0.2991 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 3492326 | 1-(3,7-dihydroxy-2,2-dimethyl-chroman-6-yl)-2-(5-methoxy-2,2-dimethyl-chromen-6-yl)ethanone |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 |  | 
 
 |