| Compound Information | SONAR Target prediction | | Name: | DIHYDROMUNDULETONE | | Unique Identifier: | SPE00210203 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C25H28O6 | | Molecular Weight: | 396.264 g/mol | | X log p: | 12.387 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1c(CC(=O)c2cc3CC(O)C(C)(C)Oc3cc2O)ccc2OC(C)(C)C=Cc21 | | Source: | derivative of mundulone | | Reference: | Proc Chem Soc 1959: 150 |
| Species: |
4932 |
| Condition: |
SPE01502108 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4743±0.075519 |
| Normalized OD Score: sc h |
1.0160±0.0161062 |
| Z-Score: |
0.3230±0.329984 |
| p-Value: |
0.753276 |
| Z-Factor: |
-8.92272 |
| Fitness Defect: |
0.2833 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|D4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2007-01-17 YYYY-MM-DD | | Plate CH Control (+): | 0.238225±0.00741 | | Plate DMSO Control (-): | 0.52945±1.72615 | | Plate Z-Factor: | 0.7776 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 3492326 |
1-(3,7-dihydroxy-2,2-dimethyl-chroman-6-yl)-2-(5-methoxy-2,2-dimethyl-chromen-6-yl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 | |
|