| Compound Information | SONAR Target prediction |
| Name: | DIHYDROMUNDULONE |
| Unique Identifier: | SPE00210201 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C26H30O6 |
| Molecular Weight: | 408.275 g/mol |
| X log p: | 8.622 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 53.99 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | COc1c2CCC(C)(C)Oc2ccc1C1COc2cc3OC(C)(C)C(O)Cc3cc2C1=O |
| Source: | derivative |
| Found: 101 nonactive as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [101] |
| Species: | 4932 |
| Condition: | ELG1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7192±0.00360624 |
| Normalized OD Score: sc h | 1.0096±0.00233134 |
| Z-Score: | 0.6038±0.152689 |
| p-Value: | 0.548296 |
| Z-Factor: | -9.54319 |
| Fitness Defect: | 0.6009 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 3953335 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 2161 | Additional Members: 6 | Rows returned: 3 |
| SPE00200011 | 0.477272727272727 |
| SPE00210203 | 0 |
| LAT001H03 | 0 |
Service provided by the
Mike Tyers Laboratory