| Compound Information | SONAR Target prediction | 
| Name: | 3-PRENYL-4-HYDROXYACETOPHENONE | 
| Unique Identifier: | SPE00203029  | 
| MolClass: |  Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 188.138 g/mol | 
| X log p: | 8.322  (online calculus) | 
| Lipinksi Failures | 1 | 
| TPSA | 17.07 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 2 | 
| Rotatable Bond Count: | 3 | 
| Canonical Smiles: | CC(C)=CCc1cc(ccc1O)C(C)=O | 
| Source: | Helianthella uniflora and Polymnia sonchifolia | 
| Reference: | Chem Ber 103: 90 (1970); 105: 863 (1972); Phytochemistry 20: 2417 (1981); 43: 1019 (1996) | 
| Therapeutics: | phytoalexin |