Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4074±0.0912168 |
Normalized OD Score: sc h |
1.4196±0.014701 |
Z-Score: |
4.1932±0.582968 |
p-Value: |
0.0000801626 |
Z-Factor: |
0.399697 |
Fitness Defect: |
9.4315 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|B2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.20 Celcius | Date: | 2006-01-20 YYYY-MM-DD | Plate CH Control (+): | 0.046475±0.00225 | Plate DMSO Control (-): | 0.47387499999999994±0.03283 | Plate Z-Factor: | 0.6131 |
| png ps pdf |
288207 |
2,5-dimethyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydro-1H-naphthalen-2-ol |
289964 |
2-(6,10-dimethyl-2-spiro[4.5]dec-9-enyl)propan-2-ol |
293325 |
(7-ethyl-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthren-1-yl)methanol |
313263 |
10,13-dimethyl-17-(3,4,5-trimethylhex-2-enyl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a] phenanthren-3-ol |
314387 |
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a ]phenanthren-3-ol |
361990 |
7-bicyclo[3.3.1]non-3-enylmethanol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|