| Compound Information | SONAR Target prediction | | Name: | EUPHOL | | Unique Identifier: | SPE00201697 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 376.32 g/mol | | X log p: | 2.412 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Class: | triterpene | | Source: | Euphorbia spp. | | Reference: | J Chem Soc 1944:249; 1958:179 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
YPT6 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4062±0.000989949 |
| Normalized OD Score: sc h |
0.8222±0.00888123 |
| Z-Score: |
-4.9752±0.241083 |
| p-Value: |
0.000000907882 |
| Z-Factor: |
0.275511 |
| Fitness Defect: |
13.9122 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 25|A8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.20 Celcius | | Date: | 2008-06-05 YYYY-MM-DD | | Plate CH Control (+): | 0.0412±0.00119 | | Plate DMSO Control (-): | 0.495425±0.01575 | | Plate Z-Factor: | 0.8683 |
|  png
ps
pdf |
| 201783 |
(3S,6aR,6bS,8aR,11R,12aS,14aS,14bS)-11-(hydroxymethyl)-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,
9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
| 246983 |
(3S,5S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,
17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 249707 |
(3R,5R,8S,10S,13R,14S,17R)-17-[(2R)-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-do
decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 271466 |
2-(4,8-dimethyl-1,2,3,3a,6,7,8,8a-octahydroazulen-2-yl)propan-2-ol |
| 271776 |
(1,4a-dimethyl-2,3,4,5,6,7,8,9,10,10a-decahydrophenanthren-1-yl)methanol |
| 287684 |
4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,7,8,9,10,11,12,12a,13,14,14a-tetradecahydro-1H-picen-3-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|
