Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
HSP104 |
Replicates: |
2 |
Raw OD Value: r im |
0.7616±0.00254558 |
Normalized OD Score: sc h |
1.0723±0.00357135 |
Z-Score: |
4.1390±0.307716 |
p-Value: |
0.0000506146 |
Z-Factor: |
0.119859 |
Fitness Defect: |
9.8913 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 25|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.50 Celcius | Date: | 2008-04-11 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00310 | Plate DMSO Control (-): | 0.6958±0.01259 | Plate Z-Factor: | 0.9269 |
| png ps pdf |
201783 |
(3S,6aR,6bS,8aR,11R,12aS,14aS,14bS)-11-(hydroxymethyl)-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8, 9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
246983 |
(3S,5S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
249707 |
(3R,5R,8S,10S,13R,14S,17R)-17-[(2R)-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-do decahydro-1H-cyclopenta[a]phenanthren-3-ol |
271466 |
2-(4,8-dimethyl-1,2,3,3a,6,7,8,8a-octahydroazulen-2-yl)propan-2-ol |
271776 |
(1,4a-dimethyl-2,3,4,5,6,7,8,9,10,10a-decahydrophenanthren-1-yl)methanol |
287684 |
4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,7,8,9,10,11,12,12a,13,14,14a-tetradecahydro-1H-picen-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|