Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
2 |
Raw OD Value: r im |
0.7914±0.000565685 |
Normalized OD Score: sc h |
1.0685±0.00628301 |
Z-Score: |
4.2201±0.351411 |
p-Value: |
0.0000396218 |
Z-Factor: |
-0.0969214 |
Fitness Defect: |
10.1361 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|B2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.10 Celcius | Date: | 2005-12-15 YYYY-MM-DD | Plate CH Control (+): | 0.041999999999999996±0.00739 | Plate DMSO Control (-): | 0.7791±0.01677 | Plate Z-Factor: | 0.9394 |
| png ps pdf |
193515 |
(3S,4S,5S,10S,13R,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-4,10,13,14-tetramethyl-1,2,3,4,5,6,7,11,12,1 5,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
193524 |
(3S,4S,5S,10S,13S,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methyl-5-methylidene-heptan-2-yl]-2,3,4,5,6,7,11 ,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
193751 |
(3R,5S,8S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,12,14,15,16,17-dod ecahydro-1H-cyclopenta[a]phenanthren-3-ol |
194497 |
(3S,10S,13R,14R,17R)-17-[(2R)-heptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1 H-cyclopenta[a]phenanthren-3-ol |
194681 |
10,13-dimethyl-17-[1-[2-(3-methylbutan-2-yl)cyclopropyl]ethyl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-ol |
195723 |
n/a |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|