| Compound Information | SONAR Target prediction |
| Name: | EUPHOL |
| Unique Identifier: | SPE00201697 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 376.32 g/mol |
| X log p: | 2.412 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 0 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 1 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C |
| Class: | triterpene |
| Source: | Euphorbia spp. |
| Reference: | J Chem Soc 1944:249; 1958:179 |
| Generic_name: | LANOSTEROL |
| Chemical_iupac_name: | LANOSTEROL |
| Drug_type: | Experimental |
| Kegg_compound_id: | C01724 |
| Drugbank_id: | EXPT02002 |
| Logp: | 7.63 |
| Cas_registry_number: | 79-63-0 |
| Drug_category: | Lanosterol Synthase inhibitor |
| Organisms_affected: | -1 |
| Found: 52 active | as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [52] |
| Species: | 4932 |
| Condition: | CIN8 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8324±0.00558614 |
| Normalized OD Score: sc h | 1.0806±0.0146724 |
| Z-Score: | 4.3877±0.73752 |
| p-Value: | 0.0000557226 |
| Z-Factor: | -0.423355 |
| Fitness Defect: | 9.7951 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 277 | [1] << Back 41 42 43 44 45 46 47 |
| 16061334 | (3S,5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodeca hydro-1H-cyclopenta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| SPE01504073 | 0.9167 |
| SPE01504051 | 0.9189 |
| SPE01500847 | 0.9189 |
| SPE00107022 | 0.9189 |
| SPE00300055 | 0.9444 |
| NRB 03722 | 0.9706 |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 |
| SPE00100583 | 0.253012048192771 |
| SPE00240470 | 0 |
Service provided by the
Mike Tyers Laboratory