| Compound Information | SONAR Target prediction | | Name: | EUPHOL | | Unique Identifier: | SPE00201697 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 376.32 g/mol | | X log p: | 2.412 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Class: | triterpene | | Source: | Euphorbia spp. | | Reference: | J Chem Soc 1944:249; 1958:179 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
BEM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6852±0.0147785 |
| Normalized OD Score: sc h |
1.1048±0.0119915 |
| Z-Score: |
5.6529±0.414389 |
| p-Value: |
0.0000000430138 |
| Z-Factor: |
-0.00411145 |
| Fitness Defect: |
16.9617 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|B2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.30 Celcius | | Date: | 2006-03-25 YYYY-MM-DD | | Plate CH Control (+): | 0.041624999999999995±0.00154 | | Plate DMSO Control (-): | 0.620925±0.01362 | | Plate Z-Factor: | 0.9283 |
| png ps pdf |
| 7171184 |
(3S,5S,10S,13S,14R,17S)-4,4,10,14-tetramethyl-17-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,13,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| 7171185 |
(3S,5S,10S,13S,14R,17S)-4,4,10,14-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,13,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| 7171186 |
(3S,5S,10S,13S,14R,17R)-4,4,10,14-tetramethyl-17-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,13,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| 7171187 |
(3S,5S,10S,13S,14R,17R)-4,4,10,14-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,13,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| 11625502 |
(3R,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16 ,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 11775820 |
(2S)-2-[2-[(3R)-2,3-dimethyl-1-cyclohexenyl]ethyl]-3-methyl-butan-1-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|