Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SLT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7860±0.0066468 |
Normalized OD Score: sc h |
1.1029±0.0214311 |
Z-Score: |
5.0751±1.04865 |
p-Value: |
0.00000733842 |
Z-Factor: |
0.00717723 |
Fitness Defect: |
11.8224 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 16|B10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09125±0.00456 | Plate DMSO Control (-): | 0.9484999999999999±0.02470 | Plate Z-Factor: | 0.8938 |
| png ps pdf |
6428679 |
(3S,4S)-4,10,13-trimethyl-17-(6-methyl-5-methylidene-heptan-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-ol |
6428680 |
(3S,4S)-17-(5,6-dimethylheptan-2-yl)-4,10,13-trimethyl-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-3-ol |
6428683 |
(3S,4S)-17-(5-ethyl-6-methyl-heptan-2-yl)-4,10,13-trimethyl-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H -cyclopenta[a]phenanthren-3-ol |
6428688 |
(3S,5S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-ol |
6428689 |
(3S,5S)-10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-3-ol |
6428690 |
(3S,5R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|