Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SLT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8367±0.0066468 |
Normalized OD Score: sc h |
1.1029±0.0214311 |
Z-Score: |
5.0751±1.04865 |
p-Value: |
0.00000733842 |
Z-Factor: |
0.00717723 |
Fitness Defect: |
11.8224 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|B2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2006-03-21 YYYY-MM-DD | Plate CH Control (+): | 0.038849999999999996±0.00114 | Plate DMSO Control (-): | 0.7513±0.00935 | Plate Z-Factor: | 0.9644 |
| png ps pdf |
5321743 |
(3S,6bS,8aR,12S,12aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,7,8,9,10,11,12,12a,13,14,14a-tetra decahydro-1H-picen-3-ol |
5358107 |
10,13-dimethyl-17-[(E)-3,4,5-trimethylhex-2-enyl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopent a[a]phenanthren-3-ol |
5358162 |
17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-3-ol |
5365664 |
[(4E)-1-cyclooct-4-enyl]methanol |
5370331 |
(5Z)-6-methylcyclodec-5-en-1-ol |
5378246 |
4,10,13-trimethyl-17-[(E)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|