Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
RBL2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7799±0.00933381 |
Normalized OD Score: sc h |
1.0739±0.0155857 |
Z-Score: |
4.1392±0.807374 |
p-Value: |
0.000180857 |
Z-Factor: |
-0.548139 |
Fitness Defect: |
8.6178 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 25|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2008-06-03 YYYY-MM-DD | Plate CH Control (+): | 0.04±0.00072 | Plate DMSO Control (-): | 0.706725±0.01567 | Plate Z-Factor: | 0.9560 |
| png ps pdf |
5317337 |
n/a |
5317423 |
(3S,10R,13S,17R)-17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1 H-cyclopenta[a]phenanthren-3-ol |
5317775 |
2,2,4a,6a,6b,9,9,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,10-diol |
5317959 |
n/a |
5318052 |
2-[(6S)-6,10-dimethyl-2-spiro[4.5]dec-9-enyl]propan-2-ol |
5318507 |
n/a |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|