Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
FAA2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7348±0.00318198 |
Normalized OD Score: sc h |
1.0849±0.00554527 |
Z-Score: |
4.6441±0.0517578 |
p-Value: |
0.00000346632 |
Z-Factor: |
-0.305304 |
Fitness Defect: |
12.5724 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 25|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2008-05-27 YYYY-MM-DD | Plate CH Control (+): | 0.040650000000000006±0.00055 | Plate DMSO Control (-): | 0.6632±0.02185 | Plate Z-Factor: | 0.8605 |
| png ps pdf |
5316994 |
(3S,10S,13R,17R)-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylidene-heptan-2-yl)-2,3,5,6,7,11,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
5317118 |
n/a |
5317269 |
2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
5317296 |
(3S,10S,14S)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H- cyclopenta[a]phenanthren-3-ol |
5317299 |
(3S,10S,14S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methyl-5-methylidene-heptan-2-yl]-2,3,5,6,7,11,12,15,16 ,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
5317314 |
(3S,6aR,6aR,8aS,14bS)-4,4,6a,6b,8a,11,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydr o-1H-picene-3,13-diol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|