| Compound Information | SONAR Target prediction | | Name: | EUPHOL | | Unique Identifier: | SPE00201697 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 376.32 g/mol | | X log p: | 2.412 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Class: | triterpene | | Source: | Euphorbia spp. | | Reference: | J Chem Soc 1944:249; 1958:179 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6690±0.000565685 |
| Normalized OD Score: sc h |
1.0685±0.00628301 |
| Z-Score: |
4.2201±0.351411 |
| p-Value: |
0.0000396218 |
| Z-Factor: |
-0.0969214 |
| Fitness Defect: |
10.1361 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 16|B10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.095±0.00484 | | Plate DMSO Control (-): | 0.9405±0.02182 | | Plate Z-Factor: | 0.9156 |
|  png
ps
pdf |
| 5316231 |
2-[(4R)-4,8-dimethyl-1-spiro[4.5]dec-8-enyl]propan-2-ol |
| 5316466 |
(10R,13S)-17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-
cyclopenta[a]phenanthren-3-ol |
| 5316709 |
(3S,10R,13S,17R)-17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodeca
hydro-1H-cyclopenta[a]phenanthren-3-ol |
| 5316742 |
2-[(5R)-6,10-dimethyl-2-spiro[4.5]dec-9-enyl]propan-2-ol |
| 5316882 |
(3S,10S,13S)-10,13-dimethyl-17-(5,5,6-trimethylheptan-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H
-cyclopenta[a]phenanthren-3-ol |
| 5316992 |
(3S,10S,13R,17R)-17-(1-hydroxy-6-methyl-5-methylidene-heptan-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11
,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|
