Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SMI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5268±0.0490025 |
Normalized OD Score: sc h |
1.5752±0.041841 |
Z-Score: |
12.0922±0.147827 |
p-Value: |
2.22466e-33 |
Z-Factor: |
0.588629 |
Fitness Defect: |
75.1857 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|B2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.10 Celcius | Date: | 2005-12-20 YYYY-MM-DD | Plate CH Control (+): | 0.039125±0.00116 | Plate DMSO Control (-): | 0.66885±0.02433 | Plate Z-Factor: | 0.8784 |
| png ps pdf |
5284618 |
(3S,9R,10R,13S,14R,17R)-4,10,13-trimethyl-17-[(E,2R)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,12,14,1 5,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
5315163 |
2-[(2R,8aR)-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
5315190 |
17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyc lopenta[a]phenanthren-3-ol |
5315464 |
n/a |
5315867 |
n/a |
5315938 |
(3S,10R,13S,17R)-4,10,13-trimethyl-17-[(E)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-do decahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|