| Compound Information | SONAR Target prediction | | Name: | EUPHOL | | Unique Identifier: | SPE00201697 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 376.32 g/mol | | X log p: | 2.412 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Class: | triterpene | | Source: | Euphorbia spp. | | Reference: | J Chem Soc 1944:249; 1958:179 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
NUM1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7693±0.00898026 |
| Normalized OD Score: sc h |
1.1428±0.00897655 |
| Z-Score: |
6.3802±0.527241 |
| p-Value: |
0.000000000950122 |
| Z-Factor: |
0.362842 |
| Fitness Defect: |
20.7744 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|B2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2006-02-10 YYYY-MM-DD | | Plate CH Control (+): | 0.0405±0.00123 | | Plate DMSO Control (-): | 0.68315±0.01547 | | Plate Z-Factor: | 0.9251 |
| png ps pdf |
| 634328 |
n/a |
| 634628 |
4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylidene-heptan-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-c yclopenta[a]phenanthren-3-ol |
| 634946 |
n/a |
| 656423 |
4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a] phenanthren-3-ol |
| 1548892 |
(3R,5S,10S,13R,14R,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 1738053 |
(3R,5R,10S,13R,14R,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|