Compound Information | SONAR Target prediction | Name: | EUPHOL | Unique Identifier: | SPE00201697 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Class: | triterpene | Source: | Euphorbia spp. | Reference: | J Chem Soc 1944:249; 1958:179 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
2 |
Raw OD Value: r im |
0.7914±0.000565685 |
Normalized OD Score: sc h |
1.0685±0.00628301 |
Z-Score: |
4.2201±0.351411 |
p-Value: |
0.0000396218 |
Z-Factor: |
-0.0969214 |
Fitness Defect: |
10.1361 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|B2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.10 Celcius | Date: | 2005-12-15 YYYY-MM-DD | Plate CH Control (+): | 0.041999999999999996±0.00739 | Plate DMSO Control (-): | 0.7791±0.01677 | Plate Z-Factor: | 0.9394 |
| png ps pdf |
556577 |
2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol |
565337 |
17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-ol |
577203 |
n/a |
578322 |
n/a |
584538 |
2,2,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,3,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phe nanthren-3-ol |
585856 |
1,1,4a,7,7-pentamethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-2-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|