Compound Information | SONAR Target prediction | Name: | FLAVOKAWAIN B | Unique Identifier: | SPE00201610 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 268.18 g/mol | X log p: | 19.808 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1cc(O)c(C(=O)C=Cc2ccccc2)c(OC)c1 | Class: | flavone | Source: | Piper, Alpinia & Myrica spp | Reference: | Z Naturforsch B 18: 370 (1963) |
Species: |
4932 |
Condition: |
SPE00305025 |
Replicates: |
2 |
Raw OD Value: r im |
0.0516±0 |
Normalized OD Score: sc h |
0.0806±0 |
Z-Score: |
-8.1416±0 |
p-Value: |
3.90146e-16 |
Z-Factor: |
0.938757 |
Fitness Defect: |
35.48 |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|C7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 0.00 Celcius | Date: | 2006-08-13 YYYY-MM-DD | Plate CH Control (+): | 0.04015±0.00215 | Plate DMSO Control (-): | 0.6607±0.01238 | Plate Z-Factor: | 0.9296 |
| png ps pdf |
101990 |
1-(2,4-dimethoxyphenyl)-3-phenyl-prop-2-en-1-one |
242589 |
1-(2-hydroxy-4,6-dimethoxy-phenyl)-3-phenyl-prop-2-en-1-one |
2775759 |
3-anthracen-9-yl-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
2840952 |
1-(2,4-dimethoxyphenyl)-3-naphthalen-1-yl-prop-2-en-1-one |
4575741 |
3-phenyl-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
5356121 |
(E)-1-(2-hydroxy-4,6-dimethoxy-phenyl)-3-phenyl-prop-2-en-1-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 | |
|