| Compound Information | SONAR Target prediction | | Name: | FLAVOKAWAIN B | | Unique Identifier: | SPE00201610 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 19.808 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1cc(O)c(C(=O)C=Cc2ccccc2)c(OC)c1 | | Class: | flavone | | Source: | Piper, Alpinia & Myrica spp | | Reference: | Z Naturforsch B 18: 370 (1963) |
| Species: |
4932 |
| Condition: |
MSO1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6958±0.0127279 |
| Normalized OD Score: sc h |
0.9640±0.00935648 |
| Z-Score: |
-1.7605±0.394309 |
| p-Value: |
0.0899238 |
| Z-Factor: |
-2.31221 |
| Fitness Defect: |
2.4088 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 11|B9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2008-02-27 YYYY-MM-DD | | Plate CH Control (+): | 0.041725±0.00073 | | Plate DMSO Control (-): | 0.688275±0.02002 | | Plate Z-Factor: | 0.8988 |
| png ps pdf |
| 101990 |
1-(2,4-dimethoxyphenyl)-3-phenyl-prop-2-en-1-one |
| 242589 |
1-(2-hydroxy-4,6-dimethoxy-phenyl)-3-phenyl-prop-2-en-1-one |
| 2775759 |
3-anthracen-9-yl-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| 2840952 |
1-(2,4-dimethoxyphenyl)-3-naphthalen-1-yl-prop-2-en-1-one |
| 4575741 |
3-phenyl-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| 5356121 |
(E)-1-(2-hydroxy-4,6-dimethoxy-phenyl)-3-phenyl-prop-2-en-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 | |
|