| Compound Information | SONAR Target prediction |
| Name: | FLAVOKAWAIN B |
| Unique Identifier: | SPE00201610 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 268.18 g/mol |
| X log p: | 19.808 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.53 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | COc1cc(O)c(C(=O)C=Cc2ccccc2)c(OC)c1 |
| Class: | flavone |
| Source: | Piper, Alpinia & Myrica spp |
| Reference: | Z Naturforsch B 18: 370 (1963) |
| Found: 276 active | as graph: single | with analogs | [1] << Back 191 192 193 194 195 196 197 198 199 200 Next >> [276] |
| Species: | 4932 |
| Condition: | ELG1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6229±0.0160513 |
| Normalized OD Score: sc h | 0.8780±0.0137459 |
| Z-Score: | -7.6497±0.94491 |
| p-Value: | 0.00000000000146022 |
| Z-Factor: | -5.13356 |
| Fitness Defect: | 27.2524 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 13 | << Back 1 2 3 |
| 11175013 | (E)-1-(2-hydroxy-4,6-dimethoxy-phenyl)-3-naphthalen-2-yl-prop-2-en-1-one |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 |
| SPE01505153 | 0.551724137931034 |
| SPE00201727 | 0.487179487179487 |
| SPE00201081 | 0.458333333333333 |
| SPE00200441 | 0 |
Service provided by the
Mike Tyers Laboratory