| Compound Information | SONAR Target prediction | | Name: | FLAVOKAWAIN B | | Unique Identifier: | SPE00201610 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 19.808 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1cc(O)c(C(=O)C=Cc2ccccc2)c(OC)c1 | | Class: | flavone | | Source: | Piper, Alpinia & Myrica spp | | Reference: | Z Naturforsch B 18: 370 (1963) |
| Species: |
4932 |
| Condition: |
SPE00240740 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7105±0.0152028 |
| Normalized OD Score: sc h |
0.9654±0.0118152 |
| Z-Score: |
-1.7116±0.505209 |
| p-Value: |
0.107091 |
| Z-Factor: |
-2.03863 |
| Fitness Defect: |
2.2341 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|C7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.50 Celcius | | Date: | 2006-11-29 YYYY-MM-DD | | Plate CH Control (+): | 0.039474999999999996±0.00223 | | Plate DMSO Control (-): | 0.7813749999999999±0.01607 | | Plate Z-Factor: | 0.9307 |
|  png
ps
pdf |
| 5708653 |
(E)-3-anthracen-9-yl-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| 5720587 |
(E)-1-(2,4-dimethoxyphenyl)-3-naphthalen-1-yl-prop-2-en-1-one |
| 5837330 |
(E)-1-(2,4-dimethoxyphenyl)-3-phenyl-prop-2-en-1-one |
| 6154317 |
(E)-3-phenyl-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| 6476742 |
(E)-1-(2,4-dimethoxyphenyl)-3-naphthalen-2-yl-prop-2-en-1-one |
| 7946155 |
(E)-1-(2,4-dimethoxyphenyl)-3-(6-methoxynaphthalen-2-yl)prop-2-en-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9714 | Additional Members: 6 | Rows returned: 4 | |
|
