| Compound Information | SONAR Target prediction |
| Name: | SERICETIN DIACETATE |
| Unique Identifier: | SPE00201584 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 460.306 g/mol |
| X log p: | 16.572 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 88.13 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 7 |
| Canonical Smiles: | CC(=O)OC1C(=O)c2c(OC=1c1ccccc1)c(CC=C(C)C)c1OC(C)(C)C=Cc1c2OC(C)=O |
| Class: | flavone |
| Source: | derivative of sericetin Mundulea spp. |
| Reference: | Proc Chem Soc 1960:177; Tetrahedron 29:3347 (1973) |
| Found: 147 nonactive | as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [147] |
| Species: | 4932 |
| Condition: | CLA4 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7114±0.0092631 |
| Normalized OD Score: sc h | 1.0387±0.0187572 |
| Z-Score: | 1.6905±0.760461 |
| p-Value: | 0.137439 |
| Z-Factor: | -3.31377 |
| Fitness Defect: | 1.9846 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 4574925 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 7497 | Additional Members: 7 | Rows returned: 4 |
| SPE00300348 | 0.476190476190476 |
| SPE00201581 | 0.463414634146341 |
| SPE00201580 | 0.180555555555556 |
| SPE00201595 | 0 |
Service provided by the
Mike Tyers Laboratory