| Compound Information | SONAR Target prediction |
| Name: | SERICETIN |
| Unique Identifier: | SPE00201581 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 380.264 g/mol |
| X log p: | 17.153 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.53 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | CC(C)=CCc1c2OC(=C(O)C(=O)c2c(O)c2C=CC(C)(C)Oc12)c1ccccc1 |
| Class: | flavone |
| Source: | Mundulea sericea, M suberosa |
| Reference: | Proc Chem Soc 1960:177; Tetrahedron 29:3347 (1973) |
| Found: 154 active | as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [154] |
| Species: | 4932 |
| Condition: | GIM3 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.4673±0.0705693 |
| Normalized OD Score: sc h | 0.6189±0.0550536 |
| Z-Score: | -11.9669±0.894484 |
| p-Value: | 4.42918e-30 |
| Z-Factor: | 0.203085 |
| Fitness Defect: | 67.5893 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 4020240 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 7497 | Additional Members: 7 | Rows returned: 4 |
| SPE00201584 | 0.527472527472527 |
| SPE00300348 | 0.476190476190476 |
| SPE00201580 | 0.180555555555556 |
| SPE00201595 | 0 |
Service provided by the
Mike Tyers Laboratory