Compound Information | SONAR Target prediction | Name: | EPIGALLOCATECHIN 3,5-DIGALLATE | Unique Identifier: | SPE00201513 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 589.309 g/mol | X log p: | 20.001 (online calculus) | Lipinksi Failures | 2 | TPSA | 61.83 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 15 | Rotatable Bond Count: | 7 | Canonical Smiles: | Oc1cc2OC(C(Cc2c(OC(=O)c2cc(O)c(O)c(O)c2)c1)OC(=O)c1cc(O)c(O)c(O)c1)c1c c(O)c(O)c(O)c1 | Class: | flavan | Source: | tea pigment |
Species: |
4932 |
Condition: |
UBP8 |
Replicates: |
2 |
Raw OD Value: r im |
0.4405±0.021991 |
Normalized OD Score: sc h |
0.6655±0.0205402 |
Z-Score: |
-13.7834±0.839771 |
p-Value: |
5.0338e-40 |
Z-Factor: |
-0.651806 |
Fitness Defect: |
90.4872 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|A2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2007-10-17 YYYY-MM-DD | Plate CH Control (+): | 0.040125±0.00046 | Plate DMSO Control (-): | 0.648075±0.09306 | Plate Z-Factor: | 0.5150 |
| png ps pdf |
DBLink | Rows returned: 3 | |
467299 |
[(2R,3R)-7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate |
3349592 |
[7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] 3,4,5-trihydroxybenzoate |
4320064 |
[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
internal high similarity DBLink | Rows returned: 4 | |
|