| Compound Information | SONAR Target prediction | | Name: | EPIGALLOCATECHIN 3,5-DIGALLATE | | Unique Identifier: | SPE00201513 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 589.309 g/mol | | X log p: | 20.001 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 61.83 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 15 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | Oc1cc2OC(C(Cc2c(OC(=O)c2cc(O)c(O)c(O)c2)c1)OC(=O)c1cc(O)c(O)c(O)c1)c1c
c(O)c(O)c(O)c1 | | Class: | flavan | | Source: | tea pigment |
| Species: |
4932 |
| Condition: |
SLT2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2809±0.0113137 |
| Normalized OD Score: sc h |
1.0062±0.0183195 |
| Z-Score: |
0.1713±0.505849 |
| p-Value: |
0.724476 |
| Z-Factor: |
-18.4074 |
| Fitness Defect: |
0.3223 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|A2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.10 Celcius | | Date: | 2006-03-21 YYYY-MM-DD | | Plate CH Control (+): | 0.038849999999999996±0.00114 | | Plate DMSO Control (-): | 0.7513±0.00935 | | Plate Z-Factor: | 0.9644 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 467299 |
[(2R,3R)-7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl]
3,4,5-trihydroxybenzoate |
| 3349592 |
[7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl]
3,4,5-trihydroxybenzoate |
| 4320064 |
[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8942 | Additional Members: 11 | Rows returned: 7 | 1 2 Next >> |
|
