| Compound Information | SONAR Target prediction | | Name: | EPIGALLOCATECHIN 3,5-DIGALLATE | | Unique Identifier: | SPE00201513 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 589.309 g/mol | | X log p: | 20.001 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 61.83 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 15 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | Oc1cc2OC(C(Cc2c(OC(=O)c2cc(O)c(O)c(O)c2)c1)OC(=O)c1cc(O)c(O)c(O)c1)c1c
c(O)c(O)c(O)c1 | | Class: | flavan | | Source: | tea pigment |
| Species: |
4932 |
| Condition: |
BY4743 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9550±0 |
| Normalized OD Score: sc h |
0.9908±0 |
| Z-Score: |
0.4298±0 |
| p-Value: |
0.66735 |
| Z-Factor: |
-4.85043 |
| Fitness Defect: |
0.4044 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 21|C5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2012-05-28 YYYY-MM-DD | | Plate CH Control (+): | 0.1±0.00759 | | Plate DMSO Control (-): | 0.953±0.01912 | | Plate Z-Factor: | 0.9060 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 467299 |
[(2R,3R)-7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl]
3,4,5-trihydroxybenzoate |
| 3349592 |
[7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl]
3,4,5-trihydroxybenzoate |
| 4320064 |
[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-(3,4,5-trihydroxybenzoyl)oxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8942 | Additional Members: 11 | Rows returned: 7 | 1 2 Next >> |
|
