| Compound Information | SONAR Target prediction | | Name: | 2-,2--BISEPIGALLOCATECHIN MONOGALLATE | | Unique Identifier: | SPE00201506 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 732.385 g/mol | | X log p: | 20.356 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 18 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | OC1Cc2c(O)cc(O)cc2OC1c1cc(O)c(O)c(O)c1c1c(O)c(O)c(O)cc1C1Oc2cc(O)cc(O) c2CC1OC(=O)c1cc(O)c(O)c(O)c1 | | Class: | flavan | | Source: | black tea constituent |
| Species: |
4932 |
| Condition: |
SAM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2329±0.0103238 |
| Normalized OD Score: sc h |
0.3617±0.0115137 |
| Z-Score: |
-32.3488±1.12656 |
| p-Value: |
0 |
| Z-Factor: |
0.0833847 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 2|H10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.70 Celcius | | Date: | 2007-09-21 YYYY-MM-DD | | Plate CH Control (+): | 0.0399±0.00019 | | Plate DMSO Control (-): | 0.638475±0.11024 | | Plate Z-Factor: | 0.4253 |
| png ps pdf |
| DBLink | Rows returned: 4 | |
| 442543 |
[(2R,3R)-2-[2-[6-[(2R,3R)-5,7-dihydroxy-3-(3,4,5-trihydroxybenzoyl)oxy-chroman-2-yl]-2,3,4-trihydroxy-ph enyl]-3,4,5-trihydroxy-phenyl]-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 467315 |
[(2R,3R)-5,7-dihydroxy-2-[3,4,5-trihydroxy-2-[2,3,4-trihydroxy-6-[(2R,3R)-3,5,7-trihydroxychroman-2-yl]p henyl]phenyl]chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 5152597 |
[2-[2-[6-[5,7-dihydroxy-3-(3,4,5-trihydroxybenzoyl)oxy-chroman-2-yl]-2,3,4-trihydroxy-phenyl]-3,4,5-trih ydroxy-phenyl]-5,7-dihydroxy-chroman-3-yl] 3,4,5-trihydroxybenzoate |
| 5152866 |
[5,7-dihydroxy-2-[3,4,5-trihydroxy-2-[2,3,4-trihydroxy-6-(3,5,7-trihydroxychroman-2-yl)phenyl]phenyl]chr oman-3-yl] 3,4,5-trihydroxybenzoate |
| internal high similarity DBLink | Rows returned: 1 | |
|