| Compound Information | SONAR Target prediction |  | Name: | GENISTEIN, 8-METHYL |  | Unique Identifier: | SPE00201355  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C16H12O5 |  | Molecular Weight: | 272.168 g/mol |  | X log p: | 12.714  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Cc1c(O)cc(O)c2C(=O)C(=COc12)c1ccc(O)cc1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		TOP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.2885±0.00523259 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0416±0.0610045 | 
	 
	
		| Z-Score: | 
		0.3456±0.508126 | 
	 
	
		| p-Value: | 
		0.734968 | 
	 
	
		| Z-Factor: | 
		-9.09023 | 
	 
	
		| Fitness Defect: | 
		0.3079 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|B11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.90 Celcius |  | Date: | 2006-04-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.040725±0.00404 |  | Plate DMSO Control (-): | 0.32405±0.01544 |  | Plate Z-Factor: | 0.7158 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 5781195 | 
		5,7-dihydroxy-3-(4-hydroxyphenyl)-8-methyl-chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 9 | 1 2 Next >>  |   
 |  nonactive | Cluster 7497 | Additional Members: 7 | Rows returned: 6 |  |   
 
 |