| Compound Information | SONAR Target prediction | | Name: | GENISTEIN, 8-METHYL | | Unique Identifier: | SPE00201355 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H12O5 | | Molecular Weight: | 272.168 g/mol | | X log p: | 12.714 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Cc1c(O)cc(O)c2C(=O)C(=COc12)c1ccc(O)cc1 |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8126±0.0163342 |
| Normalized OD Score: sc h |
1.0004±0.00420385 |
| Z-Score: |
0.0102±0.170452 |
| p-Value: |
0.90407 |
| Z-Factor: |
-10.2777 |
| Fitness Defect: |
0.1008 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|B11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.10 Celcius | | Date: | 2005-12-15 YYYY-MM-DD | | Plate CH Control (+): | 0.038400000000000004±0.00148 | | Plate DMSO Control (-): | 0.783975±0.01930 | | Plate Z-Factor: | 0.9122 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5781195 |
5,7-dihydroxy-3-(4-hydroxyphenyl)-8-methyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| nonactive | Cluster 7497 | Additional Members: 7 | Rows returned: 6 | |
|