| 
 | Compound Information | SONAR Target prediction |  | Name: | GENISTEIN, 8-METHYL |  | Unique Identifier: | SPE00201355 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C16H12O5 |  | Molecular Weight: | 272.168 g/mol |  | X log p: | 12.714  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Cc1c(O)cc(O)c2C(=O)C(=COc12)c1ccc(O)cc1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ROT2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.8314±0.000989949 |  
		| Normalized OD Score: sc h | 1.0010±0.00352447 |  
		| Z-Score: | 0.0468±0.165779 |  
		| p-Value: | 0.906784 |  
		| Z-Factor: | -20.2825 |  
		| Fitness Defect: | 0.0979 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|B11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.30 Celcius |  | Date: | 2006-05-05 YYYY-MM-DD |  | Plate CH Control (+): | 0.03825±0.00246 |  | Plate DMSO Control (-): | 0.814375±0.02354 |  | Plate Z-Factor: | 0.8994 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 5781195 | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-methyl-chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 9 | << Back 1 2 | 
 
 | active | Cluster 7497 | Additional Members: 7 | Rows returned: 5 |  | 
 
 |