Compound Information | SONAR Target prediction | Name: | GENISTEIN, 8-METHYL | Unique Identifier: | SPE00201355 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16H12O5 | Molecular Weight: | 272.168 g/mol | X log p: | 12.714 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | Cc1c(O)cc(O)c2C(=O)C(=COc12)c1ccc(O)cc1 |
Species: |
4932 |
Condition: |
GIM3 |
Replicates: |
2 |
Raw OD Value: r im |
0.7075±0.00254558 |
Normalized OD Score: sc h |
0.9788±0.00513933 |
Z-Score: |
-0.6626±0.115366 |
p-Value: |
0.509014 |
Z-Factor: |
-4.50405 |
Fitness Defect: |
0.6753 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|B11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2006-03-15 YYYY-MM-DD | Plate CH Control (+): | 0.038375±0.00196 | Plate DMSO Control (-): | 0.73515±0.01926 | Plate Z-Factor: | 0.8997 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5781195 |
5,7-dihydroxy-3-(4-hydroxyphenyl)-8-methyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 9 | << Back 1 2 |
active | Cluster 7497 | Additional Members: 7 | Rows returned: 5 | |
|