| Compound Information | SONAR Target prediction | | Name: | GENISTEIN, 8-METHYL | | Unique Identifier: | SPE00201355 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H12O5 | | Molecular Weight: | 272.168 g/mol | | X log p: | 12.714 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Cc1c(O)cc(O)c2C(=O)C(=COc12)c1ccc(O)cc1 |
| Species: |
4932 |
| Condition: |
GCN5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3701±0.104228 |
| Normalized OD Score: sc h |
0.9825±0.0667223 |
| Z-Score: |
-0.2959±1.14169 |
| p-Value: |
0.439508 |
| Z-Factor: |
-400.798 |
| Fitness Defect: |
0.8221 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|B11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2007-10-30 YYYY-MM-DD | | Plate CH Control (+): | 0.04085±0.00042 | | Plate DMSO Control (-): | 0.38149999999999995±0.03574 | | Plate Z-Factor: | 0.6392 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5781195 |
5,7-dihydroxy-3-(4-hydroxyphenyl)-8-methyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 7497 | Additional Members: 7 | Rows returned: 5 | |
|